C14H16N4O3 — CID 137375571
5-methyl-1-(2-morpholin-4-ylphenyl)triazole-4-carboxylic acid (PubChem CID 137375571) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-methyl-1-(2-morpholin-4-ylphenyl)triazole-4-carboxylic acid.
| Compound Name | 5-methyl-1-(2-morpholin-4-ylphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 137375571 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-methyl-1-(2-morpholin-4-ylphenyl)triazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nnn1-c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C14H16N4O3/c1-10-13(14(19)20)15-16-18(10)12-5-3-2-4-11(12)17-6-8-21-9-7-17/h2-5H,6-9H2,1H3,(H,19,20) |
| InChIKey | UXPOYIXOMHDIPY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |