C22H22FN3O — CID 137375981
3-(3-amino-2-methylphenyl)-6-fluoro-1-(4-hydroxycyclohexyl)indole-5-carbonitrile (PubChem CID 137375981) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-(3-amino-2-methylphenyl)-6-fluoro-1-(4-hydroxycyclohexyl)indole-5-carbonitrile.
| Compound Name | 3-(3-amino-2-methylphenyl)-6-fluoro-1-(4-hydroxycyclohexyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 137375981 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-(3-amino-2-methylphenyl)-6-fluoro-1-(4-hydroxycyclohexyl)indole-5-carbonitrile |
| SMILES | Cc1c(N)cccc1-c1cn(C2CCC(O)CC2)c2cc(F)c(C#N)cc12 |
| InChI | InChI=1S/C22H22FN3O/c1-13-17(3-2-4-21(13)25)19-12-26(15-5-7-16(27)8-6-15)22-10-20(23)14(11-24)9-18(19)22/h2-4,9-10,12,15-16,27H,5-8,25H2,1H3 |
| InChIKey | ZQAHRAIZSUELOR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|