C38H41Cl2N5O3 — CID 137376042
2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]benzoic acid (PubChem CID 137376042) has the molecular formula C38H41Cl2N5O3 and a molecular weight of 686.68 g/mol. Its IUPAC name is 2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 137376042 |
| Molecular Formula | C38H41Cl2N5O3 |
| Molecular Weight | 686.68 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | 2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]benzoic acid |
| SMILES | Cc1cc(CCCCc2c(C(=O)N3CCN(c4ccccc4C(=O)O)CC3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C38H41Cl2N5O3/c1-22-20-26(21-23(2)34(22)40)10-6-7-11-27-28-14-15-30(39)33(32-24(3)42-43(5)25(32)4)35(28)41-36(27)37(46)45-18-16-44(17-19-45)31-13-9-8-12-29(31)38(47)48/h8-9,12-15,20-21,41H,6-7,10-11,16-19H2,1-5H3,(H,47,48) |
| InChIKey | PPISPQPJDGJBCF-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.68 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|