C44H46Cl2N6O3 — CID 137376142
2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid (PubChem CID 137376142) has the molecular formula C44H46Cl2N6O3 and a molecular weight of 777.80 g/mol. Its IUPAC name is 2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 137376142 |
| Molecular Formula | C44H46Cl2N6O3 |
| Molecular Weight | 777.80 g/mol |
| Exact Mass | 776.30 |
| IUPAC Name | 2-[4-[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-1-(pyridin-3-ylmethyl)-7-(1,3,5-trimethylpyrazol-4-yl)indole-2-carbonyl]piperazin-1-yl]benzoic acid |
| SMILES | Cc1cc(CCCCc2c(C(=O)N3CCN(c4ccccc4C(=O)O)CC3)n(Cc3cccnc3)c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C44H46Cl2N6O3/c1-27-23-31(24-28(2)40(27)46)11-6-7-13-33-34-16-17-36(45)39(38-29(3)48-49(5)30(38)4)41(34)52(26-32-12-10-18-47-25-32)42(33)43(53)51-21-19-50(20-22-51)37-15-9-8-14-35(37)44(54)55/h8-10,12,14-18,23-25H,6-7,11,13,19-22,26H2,1-5H3,(H,54,55) |
| InChIKey | JEBQBUBDGRAREN-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.80 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|