About 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole
3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole (PubChem CID 137376153) has the molecular formula C17H20IN5
and a molecular weight of 421.29 g/mol. Its IUPAC name is 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole.
Molecular Properties
| Compound Name | 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole |
| PubChem CID | 137376153 |
| Molecular Formula | C17H20IN5 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole |
| SMILES | Cn1cnc(-c2ccc3c(c2)c(I)cn3CCN2CCCC2)n1 |
| InChI | InChI=1S/C17H20IN5/c1-21-12-19-17(20-21)13-4-5-16-14(10-13)15(18)11-23(16)9-8-22-6-2-3-7-22/h4-5,10-12H,2-3,6-9H2,1H3 |
| InChIKey | RLAJBOHHRLYUQS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole?
The IUPAC name of 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole (CID 137376153) is 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole.
What is the SMILES notation for 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole?
The canonical SMILES for 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole is Cn1cnc(-c2ccc3c(c2)c(I)cn3CCN2CCCC2)n1.
What is the InChIKey of 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole?
The InChIKey is RLAJBOHHRLYUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20IN5/c1-21-12-19-17(20-21)13-4-5-16-14(10-13)15(18)11-23(16)9-8-22-6-2-3-7-22/h4-5,10-12H,2-3,6-9H2,1H3.
What are the key properties of 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole?
3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole has a molecular weight of 421.29 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)-1-(2-pyrrolidin-1-ylethyl)indole is sourced from PubChem (CID 137376153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).