C12H12N4 — CID 137376309
1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole (PubChem CID 137376309) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole.
| Compound Name | 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole |
|---|---|
| PubChem CID | 137376309 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole |
| SMILES | Cn1cnc(-c2ccc3c(ccn3C)c2)n1 |
| InChI | InChI=1S/C12H12N4/c1-15-6-5-9-7-10(3-4-11(9)15)12-13-8-16(2)14-12/h3-8H,1-2H3 |
| InChIKey | VWQUGBJTAYUYQE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |