About 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole
1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole (PubChem CID 137376309) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole.
Molecular Properties
| Compound Name | 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole |
| PubChem CID | 137376309 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole |
| SMILES | Cn1cnc(-c2ccc3c(ccn3C)c2)n1 |
| InChI | InChI=1S/C12H12N4/c1-15-6-5-9-7-10(3-4-11(9)15)12-13-8-16(2)14-12/h3-8H,1-2H3 |
| InChIKey | VWQUGBJTAYUYQE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole?
The IUPAC name of 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole (CID 137376309) is 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole.
What is the SMILES notation for 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole?
The canonical SMILES for 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole is Cn1cnc(-c2ccc3c(ccn3C)c2)n1.
What is the InChIKey of 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole?
The InChIKey is VWQUGBJTAYUYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4/c1-15-6-5-9-7-10(3-4-11(9)15)12-13-8-16(2)14-12/h3-8H,1-2H3.
What are the key properties of 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole?
1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole has a molecular weight of 212.26 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(1-methyl-1,2,4-triazol-3-yl)indole is sourced from PubChem (CID 137376309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).