C35H42F5N5O3 — CID 137376362
N-[5-[2,4-difluoro-5-(2,4,4-trimethylpentan-2-ylcarbamoyl)phenyl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 137376362) has the molecular formula C35H42F5N5O3 and a molecular weight of 675.74 g/mol. Its IUPAC name is N-[5-[2,4-difluoro-5-(2,4,4-trimethylpentan-2-ylcarbamoyl)phenyl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[5-[2,4-difluoro-5-(2,4,4-trimethylpentan-2-ylcarbamoyl)phenyl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137376362 |
| Molecular Formula | C35H42F5N5O3 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | N-[5-[2,4-difluoro-5-(2,4,4-trimethylpentan-2-ylcarbamoyl)phenyl]-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(-c3cc(C(=O)NC(C)(C)CC(C)(C)C)c(F)cc3F)cc2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C35H42F5N5O3/c1-19-16-45(17-20(2)44(19)8)29-10-9-21(11-28(29)42-31(47)24-15-41-30(46)13-25(24)35(38,39)40)22-12-23(27(37)14-26(22)36)32(48)43-34(6,7)18-33(3,4)5/h9-15,19-20H,16-18H2,1-8H3,(H,41,46)(H,42,47)(H,43,48)/t19-,20+ |
| InChIKey | GHJDRILZTRXSSQ-BGYRXZFFSA-N |
| XLogP | 7.06 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |