About 2,3-dihydro-1,3-oxazole;quinazoline
2,3-dihydro-1,3-oxazole;quinazoline (PubChem CID 137376662) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2,3-dihydro-1,3-oxazole;quinazoline.
Molecular Properties
| Compound Name | 2,3-dihydro-1,3-oxazole;quinazoline |
| PubChem CID | 137376662 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2,3-dihydro-1,3-oxazole;quinazoline |
| SMILES | C1=COCN1.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2.C3H5NO/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-5-3-4-1/h1-6H;1-2,4H,3H2 |
| InChIKey | XJFKVCZKISSGCA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1,3-oxazole;quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,3-oxazole;quinazoline?
The IUPAC name of 2,3-dihydro-1,3-oxazole;quinazoline (CID 137376662) is 2,3-dihydro-1,3-oxazole;quinazoline.
What is the SMILES notation for 2,3-dihydro-1,3-oxazole;quinazoline?
The canonical SMILES for 2,3-dihydro-1,3-oxazole;quinazoline is C1=COCN1.c1ccc2ncncc2c1.
What is the InChIKey of 2,3-dihydro-1,3-oxazole;quinazoline?
The InChIKey is XJFKVCZKISSGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C3H5NO/c1-2-4-8-7(3-1)5-9-6-10-8;1-2-5-3-4-1/h1-6H;1-2,4H,3H2.
What are the key properties of 2,3-dihydro-1,3-oxazole;quinazoline?
2,3-dihydro-1,3-oxazole;quinazoline has a molecular weight of 201.23 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,3-oxazole;quinazoline is sourced from PubChem (CID 137376662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).