C32H38F5N7O — CID 137376815
4-fluoro-N-[4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-5-[2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]pyrimidin-5-yl]phenyl]-2-(trifluoromethyl)benzamide (PubChem CID 137376815) has the molecular formula C32H38F5N7O and a molecular weight of 631.69 g/mol. Its IUPAC name is 4-fluoro-N-[4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-5-[2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]pyrimidin-5-yl]phenyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-[4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-5-[2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]pyrimidin-5-yl]phenyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137376815 |
| Molecular Formula | C32H38F5N7O |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | 4-fluoro-N-[4-fluoro-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]-5-[2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]pyrimidin-5-yl]phenyl]-2-(trifluoromethyl)benzamide |
| SMILES | C[C@@H]1CN(c2ncc(-c3cc(NC(=O)c4ccc(F)cc4C(F)(F)F)c(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3F)cn2)C[C@H](C)N1C |
| InChI | InChI=1S/C32H38F5N7O/c1-18-14-43(15-19(2)41(18)5)29-11-27(34)25(22-12-38-31(39-13-22)44-16-20(3)42(6)21(4)17-44)10-28(29)40-30(45)24-8-7-23(33)9-26(24)32(35,36)37/h7-13,18-21H,14-17H2,1-6H3,(H,40,45)/t18-,19+,20-,21+ |
| InChIKey | DYHKUOKFQBAXGE-FXELSEDVSA-N |
| XLogP | 5.75 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |