C30H34F4N6O3 — CID 137376976
N-[4-fluoro-5-[1-[(2-methyl-1,3-oxazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 137376976) has the molecular formula C30H34F4N6O3 and a molecular weight of 602.63 g/mol. Its IUPAC name is N-[4-fluoro-5-[1-[(2-methyl-1,3-oxazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-[1-[(2-methyl-1,3-oxazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137376976 |
| Molecular Formula | C30H34F4N6O3 |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | N-[4-fluoro-5-[1-[(2-methyl-1,3-oxazol-5-yl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-2-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1ncc(CN2CC=C(c3cc(NC(=O)c4c[nH]c(=O)cc4C(F)(F)F)c(N4C[C@@H](C)N(C)[C@@H](C)C4)cc3F)CC2)o1 |
| InChI | InChI=1S/C30H34F4N6O3/c1-17-14-40(15-18(2)38(17)4)27-11-25(31)22(20-5-7-39(8-6-20)16-21-12-35-19(3)43-21)9-26(27)37-29(42)23-13-36-28(41)10-24(23)30(32,33)34/h5,9-13,17-18H,6-8,14-16H2,1-4H3,(H,36,41)(H,37,42)/t17-,18+ |
| InChIKey | JTBWGLCRXAWEJB-HDICACEKSA-N |
| XLogP | 4.90 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|