C30H32F4N6O2 — CID 137377224
N-[4-fluoro-5-(1-pyridin-2-yl-3,6-dihydro-2H-pyridin-4-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 137377224) has the molecular formula C30H32F4N6O2 and a molecular weight of 584.62 g/mol. Its IUPAC name is N-[4-fluoro-5-(1-pyridin-2-yl-3,6-dihydro-2H-pyridin-4-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-fluoro-5-(1-pyridin-2-yl-3,6-dihydro-2H-pyridin-4-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137377224 |
| Molecular Formula | C30H32F4N6O2 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | N-[4-fluoro-5-(1-pyridin-2-yl-3,6-dihydro-2H-pyridin-4-yl)-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCN(c4ccccn4)CC3)cc2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C30H32F4N6O2/c1-18-16-40(17-19(2)38(18)3)26-14-24(31)21(20-7-10-39(11-8-20)27-6-4-5-9-35-27)12-25(26)37-29(42)22-15-36-28(41)13-23(22)30(32,33)34/h4-7,9,12-15,18-19H,8,10-11,16-17H2,1-3H3,(H,36,41)(H,37,42)/t18-,19+ |
| InChIKey | NUJQYLHTFQKNEI-KDURUIRLSA-N |
| XLogP | 5.00 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|