C20H20F2N4O3 — CID 137377428
6-(difluoromethyl)-N-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]pyridine-2-carboxamide (PubChem CID 137377428) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-(difluoromethyl)-N-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-N-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 137377428 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-(difluoromethyl)-N-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]pyridine-2-carboxamide |
| SMILES | COc1cc2nn(C3CCOCC3)cc2cc1NC(=O)c1cccc(C(F)F)n1 |
| InChI | InChI=1S/C20H20F2N4O3/c1-28-18-10-16-12(11-26(25-16)13-5-7-29-8-6-13)9-17(18)24-20(27)15-4-2-3-14(23-15)19(21)22/h2-4,9-11,13,19H,5-8H2,1H3,(H,24,27) |
| InChIKey | IMDFGRCSXWDYBX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |