C19H12BrF6N3O4 — CID 137377660
[(4R,6S)-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-6-(trifluoromethyl)-6H-1,3-oxazin-2-yl]carbamoyl benzoate (PubChem CID 137377660) has the molecular formula C19H12BrF6N3O4 and a molecular weight of 540.21 g/mol. Its IUPAC name is [(4R,6S)-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-6-(trifluoromethyl)-6H-1,3-oxazin-2-yl]carbamoyl benzoate.
| Compound Name | [(4R,6S)-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-6-(trifluoromethyl)-6H-1,3-oxazin-2-yl]carbamoyl benzoate |
|---|---|
| PubChem CID | 137377660 |
| Molecular Formula | C19H12BrF6N3O4 |
| Molecular Weight | 540.21 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | [(4R,6S)-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-6-(trifluoromethyl)-6H-1,3-oxazin-2-yl]carbamoyl benzoate |
| SMILES | C[C@]1(c2nc(Br)ccc2F)N=C(NC(=O)OC(=O)c2ccccc2)O[C@H](C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C19H12BrF6N3O4/c1-17(12-10(21)7-8-11(20)27-12)18(22,23)14(19(24,25)26)33-15(29-17)28-16(31)32-13(30)9-5-3-2-4-6-9/h2-8,14H,1H3,(H,28,29,31)/t14-,17+/m0/s1 |
| InChIKey | MRVIKNZMNRLWBQ-WMLDXEAASA-N |
| XLogP | 4.72 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.21 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|