C8H10F2N2O — CID 137377727
2-(2,2-difluoroethoxy)-6-methylpyridin-4-amine (PubChem CID 137377727) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-6-methylpyridin-4-amine.
| Compound Name | 2-(2,2-difluoroethoxy)-6-methylpyridin-4-amine |
|---|---|
| PubChem CID | 137377727 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-6-methylpyridin-4-amine |
| SMILES | Cc1cc(N)cc(OCC(F)F)n1 |
| InChI | InChI=1S/C8H10F2N2O/c1-5-2-6(11)3-8(12-5)13-4-7(9)10/h2-3,7H,4H2,1H3,(H2,11,12) |
| InChIKey | DNGUGDFBLDRVGO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |