C15H17ClF2N2O3 — CID 137377975
3-[3-chloro-2,5-difluoro-4-(2-hydroxy-2-methylpropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 137377975) has the molecular formula C15H17ClF2N2O3 and a molecular weight of 346.76 g/mol. Its IUPAC name is 3-[3-chloro-2,5-difluoro-4-(2-hydroxy-2-methylpropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[3-chloro-2,5-difluoro-4-(2-hydroxy-2-methylpropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 137377975 |
| Molecular Formula | C15H17ClF2N2O3 |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-[3-chloro-2,5-difluoro-4-(2-hydroxy-2-methylpropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1CC(=O)NN=C1c1cc(F)c(OCC(C)(C)O)c(Cl)c1F |
| InChI | InChI=1S/C15H17ClF2N2O3/c1-7-4-10(21)19-20-13(7)8-5-9(17)14(11(16)12(8)18)23-6-15(2,3)22/h5,7,22H,4,6H2,1-3H3,(H,19,21) |
| InChIKey | LXYVJGSKSZCQLZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|