C14H15ClF2N2O4 — CID 137378182
3-[3-chloro-4-(2,2-difluoro-3-hydroxypropoxy)-2-hydroxyphenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 137378182) has the molecular formula C14H15ClF2N2O4 and a molecular weight of 348.73 g/mol. Its IUPAC name is 3-[3-chloro-4-(2,2-difluoro-3-hydroxypropoxy)-2-hydroxyphenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[3-chloro-4-(2,2-difluoro-3-hydroxypropoxy)-2-hydroxyphenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 137378182 |
| Molecular Formula | C14H15ClF2N2O4 |
| Molecular Weight | 348.73 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-[3-chloro-4-(2,2-difluoro-3-hydroxypropoxy)-2-hydroxyphenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1CC(=O)NN=C1c1ccc(OCC(F)(F)CO)c(Cl)c1O |
| InChI | InChI=1S/C14H15ClF2N2O4/c1-7-4-10(21)18-19-12(7)8-2-3-9(11(15)13(8)22)23-6-14(16,17)5-20/h2-3,7,20,22H,4-6H2,1H3,(H,18,21) |
| InChIKey | NEWQVLGGLFNZGZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.73 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|