C37H69N3O5 — CID 137378199
bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;2,2,6,6-tetramethylpiperidin-4-one (PubChem CID 137378199) has the molecular formula C37H69N3O5 and a molecular weight of 635.97 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;2,2,6,6-tetramethylpiperidin-4-one.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;2,2,6,6-tetramethylpiperidin-4-one |
|---|---|
| PubChem CID | 137378199 |
| Molecular Formula | C37H69N3O5 |
| Molecular Weight | 635.97 g/mol |
| Exact Mass | 635.52 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;2,2,6,6-tetramethylpiperidin-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1.CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C28H52N2O4.C9H17NO/c1-25(2)17-21(18-26(3,4)29-25)33-23(31)15-13-11-9-10-12-14-16-24(32)34-22-19-27(5,6)30-28(7,8)20-22;1-8(2)5-7(11)6-9(3,4)10-8/h21-22,29-30H,9-20H2,1-8H3;10H,5-6H2,1-4H3 |
| InChIKey | QZUZXKGLHTYBPK-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.97 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|