About (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile
(5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile (PubChem CID 137378568) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile.
Molecular Properties
| Compound Name | (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile |
| PubChem CID | 137378568 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile |
| SMILES | N#CN1CC[C@]2(CCNC2=O)C1 |
| InChI | InChI=1S/C8H11N3O/c9-6-11-4-2-8(5-11)1-3-10-7(8)12/h1-5H2,(H,10,12)/t8-/m1/s1 |
| InChIKey | QEPOMPAAPNDUNU-MRVPVSSYSA-N |
| XLogP | -0.32 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
The IUPAC name of (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile (CID 137378568) is (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile.
What is the SMILES notation for (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
The canonical SMILES for (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile is N#CN1CC[C@]2(CCNC2=O)C1.
What is the InChIKey of (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
The InChIKey is QEPOMPAAPNDUNU-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H11N3O/c9-6-11-4-2-8(5-11)1-3-10-7(8)12/h1-5H2,(H,10,12)/t8-/m1/s1.
What are the key properties of (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile?
(5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile has a molecular weight of 165.20 g/mol, XLogP of -0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile is sourced from PubChem (CID 137378568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).