C18H20F3N7OS — CID 137379517
N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 137379517) has the molecular formula C18H20F3N7OS and a molecular weight of 439.47 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 137379517 |
| Molecular Formula | C18H20F3N7OS |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(OCC(F)(F)F)cccn3n2)n1 |
| InChI | InChI=1S/C18H20F3N7OS/c1-10-22-17(30-26-10)27-7-11-4-5-12(8-27)14(11)23-16-24-15-13(29-9-18(19,20)21)3-2-6-28(15)25-16/h2-3,6,11-12,14H,4-5,7-9H2,1H3,(H,23,25)/t11-,12+,14? |
| InChIKey | QRNBVQVYYYFGKJ-ONXXMXGDSA-N |
| XLogP | 3.16 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |