C28H26N6OS — CID 137379639
1-[[5-[3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-3-pyridinyl]amino]butan-1-ol (PubChem CID 137379639) has the molecular formula C28H26N6OS and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[[5-[3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-3-pyridinyl]amino]butan-1-ol.
| Compound Name | 1-[[5-[3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-3-pyridinyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 137379639 |
| Molecular Formula | C28H26N6OS |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[[5-[3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-1H-pyrazolo[3,4-c]pyridin-5-yl]-3-pyridinyl]amino]butan-1-ol |
| SMILES | CCCC(O)Nc1cncc(-c2cc3c(-c4cc5c(-c6ccc(C)s6)cccc5[nH]4)n[nH]c3cn2)c1 |
| InChI | InChI=1S/C28H26N6OS/c1-3-5-27(35)31-18-10-17(13-29-14-18)23-12-21-25(15-30-23)33-34-28(21)24-11-20-19(6-4-7-22(20)32-24)26-9-8-16(2)36-26/h4,6-15,27,31-32,35H,3,5H2,1-2H3,(H,33,34) |
| InChIKey | PQNGWODJGRCOLT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|