C28H49NO4 — CID 137379686
1-O-tert-butyl 2-O-[(9Z,12Z)-octadeca-9,12-dienyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 137379686) has the molecular formula C28H49NO4 and a molecular weight of 463.70 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(9Z,12Z)-octadeca-9,12-dienyl] (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[(9Z,12Z)-octadeca-9,12-dienyl] (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 137379686 |
| Molecular Formula | C28H49NO4 |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.37 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(9Z,12Z)-octadeca-9,12-dienyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H49NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-32-26(30)25-22-21-23-29(25)27(31)33-28(2,3)4/h9-10,12-13,25H,5-8,11,14-24H2,1-4H3/b10-9-,13-12-/t25-/m0/s1 |
| InChIKey | TXBVQFSBJAUFRZ-YMVLYFQPSA-N |
| XLogP | 7.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|