C19H30F2N6O3 — CID 137379970
2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]-N-[(3S)-piperidin-3-yl]pyrimidine-5-carboxamide (PubChem CID 137379970) has the molecular formula C19H30F2N6O3 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]-N-[(3S)-piperidin-3-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]-N-[(3S)-piperidin-3-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137379970 |
| Molecular Formula | C19H30F2N6O3 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-[2-(difluoromethoxy)ethylamino]-4-[(4-hydroxycyclohexyl)amino]-N-[(3S)-piperidin-3-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(N[C@H]1CCCNC1)c1cnc(NCCOC(F)F)nc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C19H30F2N6O3/c20-18(21)30-9-8-23-19-24-11-15(17(29)26-13-2-1-7-22-10-13)16(27-19)25-12-3-5-14(28)6-4-12/h11-14,18,22,28H,1-10H2,(H,26,29)(H2,23,24,25,27)/t12?,13-,14?/m0/s1 |
| InChIKey | ZXLQTWJHSWUXLF-MOKVOYLWSA-N |
| XLogP | 1.32 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|