C23H28FIN4O4S — CID 137380119
1-[4-fluoro-2-(2-methoxy-4-pyridinyl)-6-propan-2-ylphenyl]-3-[1-(1-iodocyclobutyl)azetidin-3-yl]sulfonylurea (PubChem CID 137380119) has the molecular formula C23H28FIN4O4S and a molecular weight of 602.47 g/mol. Its IUPAC name is 1-[4-fluoro-2-(2-methoxy-4-pyridinyl)-6-propan-2-ylphenyl]-3-[1-(1-iodocyclobutyl)azetidin-3-yl]sulfonylurea.
| Compound Name | 1-[4-fluoro-2-(2-methoxy-4-pyridinyl)-6-propan-2-ylphenyl]-3-[1-(1-iodocyclobutyl)azetidin-3-yl]sulfonylurea |
|---|---|
| PubChem CID | 137380119 |
| Molecular Formula | C23H28FIN4O4S |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 1-[4-fluoro-2-(2-methoxy-4-pyridinyl)-6-propan-2-ylphenyl]-3-[1-(1-iodocyclobutyl)azetidin-3-yl]sulfonylurea |
| SMILES | COc1cc(-c2cc(F)cc(C(C)C)c2NC(=O)NS(=O)(=O)C2CN(C3(I)CCC3)C2)ccn1 |
| InChI | InChI=1S/C23H28FIN4O4S/c1-14(2)18-10-16(24)11-19(15-5-8-26-20(9-15)33-3)21(18)27-22(30)28-34(31,32)17-12-29(13-17)23(25)6-4-7-23/h5,8-11,14,17H,4,6-7,12-13H2,1-3H3,(H2,27,28,30) |
| InChIKey | BJSYGHSSJKQPTN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|