About 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene
7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene (PubChem CID 137380230) has the molecular formula C11H13I
and a molecular weight of 272.13 g/mol. Its IUPAC name is 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene.
Molecular Properties
| Compound Name | 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene |
| PubChem CID | 137380230 |
| Molecular Formula | C11H13I |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene |
| SMILES | CCC1c2ccc(cc2)C1CI |
| InChI | InChI=1S/C11H13I/c1-2-10-8-3-5-9(6-4-8)11(10)7-12/h3-6,10-11H,2,7H2,1H3 |
| InChIKey | RWVFPCDVMSLVKU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene?
The IUPAC name of 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene (CID 137380230) is 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene.
What is the SMILES notation for 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene?
The canonical SMILES for 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene is CCC1c2ccc(cc2)C1CI.
What is the InChIKey of 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene?
The InChIKey is RWVFPCDVMSLVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13I/c1-2-10-8-3-5-9(6-4-8)11(10)7-12/h3-6,10-11H,2,7H2,1H3.
What are the key properties of 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene?
7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene has a molecular weight of 272.13 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-8-(iodomethyl)bicyclo[2.2.2]octa-1,3,5-triene is sourced from PubChem (CID 137380230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).