C51H52O2S3 — CID 137380526
2-[9,9-dihexyl-7-[5-(4-methoxyphenyl)thiophen-2-yl]fluoren-2-yl]-5-[5-(4-methoxyphenyl)thiophen-2-yl]thiophene (PubChem CID 137380526) has the molecular formula C51H52O2S3 and a molecular weight of 793.18 g/mol. Its IUPAC name is 2-[9,9-dihexyl-7-[5-(4-methoxyphenyl)thiophen-2-yl]fluoren-2-yl]-5-[5-(4-methoxyphenyl)thiophen-2-yl]thiophene.
| Compound Name | 2-[9,9-dihexyl-7-[5-(4-methoxyphenyl)thiophen-2-yl]fluoren-2-yl]-5-[5-(4-methoxyphenyl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 137380526 |
| Molecular Formula | C51H52O2S3 |
| Molecular Weight | 793.18 g/mol |
| Exact Mass | 792.31 |
| IUPAC Name | 2-[9,9-dihexyl-7-[5-(4-methoxyphenyl)thiophen-2-yl]fluoren-2-yl]-5-[5-(4-methoxyphenyl)thiophen-2-yl]thiophene |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3ccc(-c4ccc(OC)cc4)s3)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(OC)cc5)s4)s3)cc21 |
| InChI | InChI=1S/C51H52O2S3/c1-5-7-9-11-31-51(32-12-10-8-6-2)43-33-37(47-26-25-45(54-47)35-13-19-39(52-3)20-14-35)17-23-41(43)42-24-18-38(34-44(42)51)48-28-30-50(56-48)49-29-27-46(55-49)36-15-21-40(53-4)22-16-36/h13-30,33-34H,5-12,31-32H2,1-4H3 |
| InChIKey | LEJYWGHGNRDJLS-UHFFFAOYSA-N |
| XLogP | 16.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.18 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|