C17H27F2N7O2 — CID 137380999
(NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-(2,2-dimethylpropoxy)pyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine (PubChem CID 137380999) has the molecular formula C17H27F2N7O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is (NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-(2,2-dimethylpropoxy)pyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-(2,2-dimethylpropoxy)pyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137380999 |
| Molecular Formula | C17H27F2N7O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-(2,2-dimethylpropoxy)pyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine |
| SMILES | [H]/N=C(C)/C(CNc1nc(OCC(C)(C)C)nc(N2CCC(F)(F)C2)c1N)=N\O |
| InChI | InChI=1S/C17H27F2N7O2/c1-10(20)11(25-27)7-22-13-12(21)14(26-6-5-17(18,19)8-26)24-15(23-13)28-9-16(2,3)4/h20,27H,5-9,21H2,1-4H3,(H,22,23,24)/b20-10+,25-11- |
| InChIKey | PGAOIOMXRJRWGB-XEJCLTMCSA-N |
| XLogP | 2.61 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|