C14H17F8N5O — CID 137381114
6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-4-N-(3,3,3-trifluoropropyl)pyrimidine-4,5-diamine (PubChem CID 137381114) has the molecular formula C14H17F8N5O and a molecular weight of 423.31 g/mol. Its IUPAC name is 6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-4-N-(3,3,3-trifluoropropyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-4-N-(3,3,3-trifluoropropyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 137381114 |
| Molecular Formula | C14H17F8N5O |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-4-N-(3,3,3-trifluoropropyl)pyrimidine-4,5-diamine |
| SMILES | C[C@H](Oc1nc(NCCC(F)(F)F)c(N)c(N2CCC(F)(F)C2)n1)C(F)(F)F |
| InChI | InChI=1S/C14H17F8N5O/c1-7(14(20,21)22)28-11-25-9(24-4-2-13(17,18)19)8(23)10(26-11)27-5-3-12(15,16)6-27/h7H,2-6,23H2,1H3,(H,24,25,26)/t7-/m0/s1 |
| InChIKey | SWGRHTJEGWGMQG-ZETCQYMHSA-N |
| XLogP | 3.60 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |