C15H20F5N7O2 — CID 137381204
(NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine (PubChem CID 137381204) has the molecular formula C15H20F5N7O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is (NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137381204 |
| Molecular Formula | C15H20F5N7O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (NZ)-N-[1-[[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxypyrimidin-4-yl]amino]-3-iminobutan-2-ylidene]hydroxylamine |
| SMILES | [H]/N=C(C)/C(CNc1nc(O[C@@H](C)C(F)(F)F)nc(N2CCC(F)(F)C2)c1N)=N\O |
| InChI | InChI=1S/C15H20F5N7O2/c1-7(21)9(26-28)5-23-11-10(22)12(27-4-3-14(16,17)6-27)25-13(24-11)29-8(2)15(18,19)20/h8,21,28H,3-6,22H2,1-2H3,(H,23,24,25)/b21-7+,26-9-/t8-/m0/s1 |
| InChIKey | GZNILWSBRNNRCO-RXMFZLSDSA-N |
| XLogP | 2.52 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|