About (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene
(3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene (PubChem CID 137381294) has the molecular formula C11H17F3O
and a molecular weight of 222.25 g/mol. Its IUPAC name is (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene.
Molecular Properties
| Compound Name | (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene |
| PubChem CID | 137381294 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene |
| SMILES | CC/C=C(\C=C/C(C)OC(F)(F)F)CC |
| InChI | InChI=1S/C11H17F3O/c1-4-6-10(5-2)8-7-9(3)15-11(12,13)14/h6-9H,4-5H2,1-3H3/b8-7-,10-6- |
| InChIKey | NJGIAZTXSHPHSL-OYIUBJQVSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene?
The IUPAC name of (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene (CID 137381294) is (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene.
What is the SMILES notation for (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene?
The canonical SMILES for (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene is CC/C=C(\C=C/C(C)OC(F)(F)F)CC.
What is the InChIKey of (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene?
The InChIKey is NJGIAZTXSHPHSL-OYIUBJQVSA-N. The full InChI is InChI=1S/C11H17F3O/c1-4-6-10(5-2)8-7-9(3)15-11(12,13)14/h6-9H,4-5H2,1-3H3/b8-7-,10-6-.
What are the key properties of (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene?
(3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene has a molecular weight of 222.25 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-5-ethyl-2-(trifluoromethoxy)octa-3,5-diene is sourced from PubChem (CID 137381294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).