C14H30N2 — CID 137381493
5-N,5-N,2,4,6,7-hexamethyloct-7-ene-1,5-diamine (PubChem CID 137381493) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 5-N,5-N,2,4,6,7-hexamethyloct-7-ene-1,5-diamine.
| Compound Name | 5-N,5-N,2,4,6,7-hexamethyloct-7-ene-1,5-diamine |
|---|---|
| PubChem CID | 137381493 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 5-N,5-N,2,4,6,7-hexamethyloct-7-ene-1,5-diamine |
| SMILES | C=C(C)C(C)C(C(C)CC(C)CN)N(C)C |
| InChI | InChI=1S/C14H30N2/c1-10(2)13(5)14(16(6)7)12(4)8-11(3)9-15/h11-14H,1,8-9,15H2,2-7H3 |
| InChIKey | LOMPYQCPJLZPDR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|