C16H24N2 — CID 137382322
1-methyl-3-[2-[(4E)-4-pent-4-enylidenecyclohexa-1,5-dien-1-yl]ethyl]-1,3-diazetidine (PubChem CID 137382322) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-methyl-3-[2-[(4E)-4-pent-4-enylidenecyclohexa-1,5-dien-1-yl]ethyl]-1,3-diazetidine.
| Compound Name | 1-methyl-3-[2-[(4E)-4-pent-4-enylidenecyclohexa-1,5-dien-1-yl]ethyl]-1,3-diazetidine |
|---|---|
| PubChem CID | 137382322 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-methyl-3-[2-[(4E)-4-pent-4-enylidenecyclohexa-1,5-dien-1-yl]ethyl]-1,3-diazetidine |
| SMILES | C=CCC/C=C1/C=CC(CCN2CN(C)C2)=CC1 |
| InChI | InChI=1S/C16H24N2/c1-3-4-5-6-15-7-9-16(10-8-15)11-12-18-13-17(2)14-18/h3,6-7,9-10H,1,4-5,8,11-14H2,2H3/b15-6- |
| InChIKey | LRDXLCMOTJCFSV-UUASQNMZSA-N |
| XLogP | 3.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|