C17H29NO3 — CID 137382477
tert-butyl N-[(4Z,6Z)-4-[(3S)-3-hydroxybut-1-en-2-yl]octa-4,6-dienyl]carbamate (PubChem CID 137382477) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is tert-butyl N-[(4Z,6Z)-4-[(3S)-3-hydroxybut-1-en-2-yl]octa-4,6-dienyl]carbamate.
| Compound Name | tert-butyl N-[(4Z,6Z)-4-[(3S)-3-hydroxybut-1-en-2-yl]octa-4,6-dienyl]carbamate |
|---|---|
| PubChem CID | 137382477 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | tert-butyl N-[(4Z,6Z)-4-[(3S)-3-hydroxybut-1-en-2-yl]octa-4,6-dienyl]carbamate |
| SMILES | C=C(/C(=C\C=C/C)CCCNC(=O)OC(C)(C)C)[C@H](C)O |
| InChI | InChI=1S/C17H29NO3/c1-7-8-10-15(13(2)14(3)19)11-9-12-18-16(20)21-17(4,5)6/h7-8,10,14,19H,2,9,11-12H2,1,3-6H3,(H,18,20)/b8-7-,15-10-/t14-/m0/s1 |
| InChIKey | WMPZWPDLOCDBGG-CEGYENLRSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|