About 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one
8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 137382819) has the molecular formula C8H7FN2O2
and a molecular weight of 182.15 g/mol. Its IUPAC name is 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one.
Molecular Properties
| Compound Name | 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one |
| PubChem CID | 137382819 |
| Molecular Formula | C8H7FN2O2 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | O=C1NCc2c(O)ccc(F)c2N1 |
| InChI | InChI=1S/C8H7FN2O2/c9-5-1-2-6(12)4-3-10-8(13)11-7(4)5/h1-2,12H,3H2,(H2,10,11,13) |
| InChIKey | DDNWGTHRFWQAJM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one?
The IUPAC name of 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one (CID 137382819) is 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one.
What is the SMILES notation for 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one?
The canonical SMILES for 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one is O=C1NCc2c(O)ccc(F)c2N1.
What is the InChIKey of 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one?
The InChIKey is DDNWGTHRFWQAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2O2/c9-5-1-2-6(12)4-3-10-8(13)11-7(4)5/h1-2,12H,3H2,(H2,10,11,13).
What are the key properties of 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one?
8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one has a molecular weight of 182.15 g/mol, XLogP of 1.17, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-hydroxy-3,4-dihydro-1H-quinazolin-2-one is sourced from PubChem (CID 137382819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).