C27H33F2N3O — CID 137382834
N'-[(Z)-2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]prop-1-enyl]-4-methyl-N-[(E)-prop-1-enyl]benzenecarboximidamide (PubChem CID 137382834) has the molecular formula C27H33F2N3O and a molecular weight of 453.58 g/mol. Its IUPAC name is N'-[(Z)-2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]prop-1-enyl]-4-methyl-N-[(E)-prop-1-enyl]benzenecarboximidamide.
| Compound Name | N'-[(Z)-2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]prop-1-enyl]-4-methyl-N-[(E)-prop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 137382834 |
| Molecular Formula | C27H33F2N3O |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N'-[(Z)-2-[[1-(2,6-difluoro-4-methylphenyl)piperidin-4-yl]methoxy]prop-1-enyl]-4-methyl-N-[(E)-prop-1-enyl]benzenecarboximidamide |
| SMILES | C/C=C/N/C(=N\C=C(\C)OCC1CCN(c2c(F)cc(C)cc2F)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H33F2N3O/c1-5-12-30-27(23-8-6-19(2)7-9-23)31-17-21(4)33-18-22-10-13-32(14-11-22)26-24(28)15-20(3)16-25(26)29/h5-9,12,15-17,22H,10-11,13-14,18H2,1-4H3,(H,30,31)/b12-5+,21-17- |
| InChIKey | RCUQHBZHXDQYFZ-ZYHGJJHFSA-N |
| XLogP | 6.25 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|