C16H27NO2 — CID 137383035
3-(2-methoxyethoxy)-1-[(3Z,6Z)-6-methylocta-1,3,6-trien-2-yl]pyrrolidine (PubChem CID 137383035) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-1-[(3Z,6Z)-6-methylocta-1,3,6-trien-2-yl]pyrrolidine.
| Compound Name | 3-(2-methoxyethoxy)-1-[(3Z,6Z)-6-methylocta-1,3,6-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 137383035 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 3-(2-methoxyethoxy)-1-[(3Z,6Z)-6-methylocta-1,3,6-trien-2-yl]pyrrolidine |
| SMILES | C=C(/C=C\C/C(C)=C\C)N1CCC(OCCOC)C1 |
| InChI | InChI=1S/C16H27NO2/c1-5-14(2)7-6-8-15(3)17-10-9-16(13-17)19-12-11-18-4/h5-6,8,16H,3,7,9-13H2,1-2,4H3/b8-6-,14-5- |
| InChIKey | CEJMUCLLTJXZLC-KJDQYJRRSA-N |
| XLogP | 3.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|