About (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine
(E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine (PubChem CID 137383122) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine |
| PubChem CID | 137383122 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine |
| SMILES | CC/C=C(\CN(C)C)NC(CC)NC(C)C |
| InChI | InChI=1S/C13H29N3/c1-7-9-12(10-16(5)6)15-13(8-2)14-11(3)4/h9,11,13-15H,7-8,10H2,1-6H3/b12-9+ |
| InChIKey | YADZKLPHDYSGNK-FMIVXFBMSA-N |
| XLogP | 2.17 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine?
The IUPAC name of (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine (CID 137383122) is (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine.
What is the SMILES notation for (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine?
The canonical SMILES for (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine is CC/C=C(\CN(C)C)NC(CC)NC(C)C.
What is the InChIKey of (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine?
The InChIKey is YADZKLPHDYSGNK-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H29N3/c1-7-9-12(10-16(5)6)15-13(8-2)14-11(3)4/h9,11,13-15H,7-8,10H2,1-6H3/b12-9+.
What are the key properties of (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine?
(E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine has a molecular weight of 227.40 g/mol, XLogP of 2.17, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N,1-N-dimethyl-2-N-[1-(propan-2-ylamino)propyl]pent-2-ene-1,2-diamine is sourced from PubChem (CID 137383122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).