About 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine
3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine (PubChem CID 137383305) has the molecular formula C10H14BrNO
and a molecular weight of 244.13 g/mol. Its IUPAC name is 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine.
Molecular Properties
| Compound Name | 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine |
| PubChem CID | 137383305 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine |
| SMILES | BrC1=CCC(OC2CCNC2)C=C1 |
| InChI | InChI=1S/C10H14BrNO/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10/h1-3,9-10,12H,4-7H2 |
| InChIKey | KELHGFRCMFWYOI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine?
The IUPAC name of 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine (CID 137383305) is 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine.
What is the SMILES notation for 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine?
The canonical SMILES for 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine is BrC1=CCC(OC2CCNC2)C=C1.
What is the InChIKey of 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine?
The InChIKey is KELHGFRCMFWYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrNO/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10/h1-3,9-10,12H,4-7H2.
What are the key properties of 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine?
3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine has a molecular weight of 244.13 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromocyclohexa-2,4-dien-1-yl)oxypyrrolidine is sourced from PubChem (CID 137383305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).