C15H24N2 — CID 137383519
1-but-1-en-2-yl-2-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]hydrazine (PubChem CID 137383519) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-but-1-en-2-yl-2-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]hydrazine.
| Compound Name | 1-but-1-en-2-yl-2-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 137383519 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-but-1-en-2-yl-2-[(5Z,7Z)-5-ethenylnona-1,5,7-trien-2-yl]hydrazine |
| SMILES | C=C/C(=C\C=C/C)CCC(=C)NNC(=C)CC |
| InChI | InChI=1S/C15H24N2/c1-6-9-10-15(8-3)12-11-14(5)17-16-13(4)7-2/h6,8-10,16-17H,3-5,7,11-12H2,1-2H3/b9-6-,15-10+ |
| InChIKey | HBGPVLABXNLBBW-SYFSHSHVSA-N |
| XLogP | 3.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|