C19H23ClFN4O2+ — CID 137383816
N-[5-chloro-2-methyl-3-(piperazin-1-ylmethyl)phenyl]-5-fluoro-1-hydroxy-6-methylpyridin-1-ium-3-carboxamide (PubChem CID 137383816) has the molecular formula C19H23ClFN4O2+ and a molecular weight of 393.87 g/mol. Its IUPAC name is N-[5-chloro-2-methyl-3-(piperazin-1-ylmethyl)phenyl]-5-fluoro-1-hydroxy-6-methylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[5-chloro-2-methyl-3-(piperazin-1-ylmethyl)phenyl]-5-fluoro-1-hydroxy-6-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 137383816 |
| Molecular Formula | C19H23ClFN4O2+ |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[5-chloro-2-methyl-3-(piperazin-1-ylmethyl)phenyl]-5-fluoro-1-hydroxy-6-methylpyridin-1-ium-3-carboxamide |
| SMILES | Cc1c(CN2CCNCC2)cc(Cl)cc1NC(=O)c1cc(F)c(C)[n+](O)c1 |
| InChI | InChI=1S/C19H22ClFN4O2/c1-12-14(10-24-5-3-22-4-6-24)7-16(20)9-18(12)23-19(26)15-8-17(21)13(2)25(27)11-15/h7-9,11,22H,3-6,10H2,1-2H3,(H-,23,26,27)/p+1 |
| InChIKey | JSNDQXYDTIFXBK-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 68.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|