C46H34N2S — CID 137383865
1-(8,9-dihydrodibenzothiophen-4-yl)-N-[(1E)-2-[6-[6-(9H-fluoren-1-yl)-3-pyridinyl]naphthalen-1-yl]buta-1,3-dienyl]ethanimine (PubChem CID 137383865) has the molecular formula C46H34N2S and a molecular weight of 646.86 g/mol. Its IUPAC name is 1-(8,9-dihydrodibenzothiophen-4-yl)-N-[(1E)-2-[6-[6-(9H-fluoren-1-yl)-3-pyridinyl]naphthalen-1-yl]buta-1,3-dienyl]ethanimine.
| Compound Name | 1-(8,9-dihydrodibenzothiophen-4-yl)-N-[(1E)-2-[6-[6-(9H-fluoren-1-yl)-3-pyridinyl]naphthalen-1-yl]buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 137383865 |
| Molecular Formula | C46H34N2S |
| Molecular Weight | 646.86 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 1-(8,9-dihydrodibenzothiophen-4-yl)-N-[(1E)-2-[6-[6-(9H-fluoren-1-yl)-3-pyridinyl]naphthalen-1-yl]buta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(=C\N=C(/C)c1cccc2c3c(sc12)C=CCC3)c1cccc2cc(-c3ccc(-c4cccc5c4Cc4ccccc4-5)nc3)ccc12 |
| InChI | InChI=1S/C46H34N2S/c1-3-30(27-47-29(2)35-15-9-19-42-41-14-6-7-20-45(41)49-46(35)42)36-16-8-12-32-25-31(21-23-38(32)36)34-22-24-44(48-28-34)40-18-10-17-39-37-13-5-4-11-33(37)26-43(39)40/h3-5,7-13,15-25,27-28H,1,6,14,26H2,2H3/b30-27+,47-29+ |
| InChIKey | OREQZXAYHAOOPV-WLLOYMERSA-N |
| XLogP | 12.35 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.86 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|