C13H27N — CID 137384042
N,4,4,6,6-pentamethyloct-1-en-3-amine (PubChem CID 137384042) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N,4,4,6,6-pentamethyloct-1-en-3-amine.
| Compound Name | N,4,4,6,6-pentamethyloct-1-en-3-amine |
|---|---|
| PubChem CID | 137384042 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N,4,4,6,6-pentamethyloct-1-en-3-amine |
| SMILES | C=CC(NC)C(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C13H27N/c1-8-11(14-7)13(5,6)10-12(3,4)9-2/h8,11,14H,1,9-10H2,2-7H3 |
| InChIKey | MESPEPUBCQQYTN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|