About 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol
6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol (PubChem CID 137384078) has the molecular formula C16H25BrN4O2
and a molecular weight of 385.31 g/mol. Its IUPAC name is 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol.
Molecular Properties
| Compound Name | 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol |
| PubChem CID | 137384078 |
| Molecular Formula | C16H25BrN4O2 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol |
| SMILES | CCNc1nc(C)c2c(n1)N(CCCOC(C)C)C(O)C(Br)=C2 |
| InChI | InChI=1S/C16H25BrN4O2/c1-5-18-16-19-11(4)12-9-13(17)15(22)21(14(12)20-16)7-6-8-23-10(2)3/h9-10,15,22H,5-8H2,1-4H3,(H,18,19,20) |
| InChIKey | PGTPXOGTSJVRSF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol?
The IUPAC name of 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol (CID 137384078) is 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol.
What is the SMILES notation for 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol?
The canonical SMILES for 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol is CCNc1nc(C)c2c(n1)N(CCCOC(C)C)C(O)C(Br)=C2.
What is the InChIKey of 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol?
The InChIKey is PGTPXOGTSJVRSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25BrN4O2/c1-5-18-16-19-11(4)12-9-13(17)15(22)21(14(12)20-16)7-6-8-23-10(2)3/h9-10,15,22H,5-8H2,1-4H3,(H,18,19,20).
What are the key properties of 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol?
6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol has a molecular weight of 385.31 g/mol, XLogP of 2.91, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(ethylamino)-4-methyl-8-(3-propan-2-yloxypropyl)-7H-pyrido[2,3-d]pyrimidin-7-ol is sourced from PubChem (CID 137384078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).