About 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol
8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol (PubChem CID 137384082) has the molecular formula C16H24N4O
and a molecular weight of 288.40 g/mol. Its IUPAC name is 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol.
Molecular Properties
| Compound Name | 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol |
| PubChem CID | 137384082 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol |
| SMILES | CCNc1nc(C)c2c(n1)N(C1CCCCC1)C(O)C=C2 |
| InChI | InChI=1S/C16H24N4O/c1-3-17-16-18-11(2)13-9-10-14(21)20(15(13)19-16)12-7-5-4-6-8-12/h9-10,12,14,21H,3-8H2,1-2H3,(H,17,18,19) |
| InChIKey | QRNGJHLFHKOHRL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol?
The IUPAC name of 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol (CID 137384082) is 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol.
What is the SMILES notation for 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol?
The canonical SMILES for 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol is CCNc1nc(C)c2c(n1)N(C1CCCCC1)C(O)C=C2.
What is the InChIKey of 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol?
The InChIKey is QRNGJHLFHKOHRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O/c1-3-17-16-18-11(2)13-9-10-14(21)20(15(13)19-16)12-7-5-4-6-8-12/h9-10,12,14,21H,3-8H2,1-2H3,(H,17,18,19).
What are the key properties of 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol?
8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol has a molecular weight of 288.40 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclohexyl-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol is sourced from PubChem (CID 137384082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).