About 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one
2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 137384116) has the molecular formula C18H27N5O
and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 137384116 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCNc1nc(C)c2cc(C)c(=O)n(CCN3CCCCC3)c2n1 |
| InChI | InChI=1S/C18H27N5O/c1-4-19-18-20-14(3)15-12-13(2)17(24)23(16(15)21-18)11-10-22-8-6-5-7-9-22/h12H,4-11H2,1-3H3,(H,19,20,21) |
| InChIKey | HITXKAWJFCVWTM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one (CID 137384116) is 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one is CCNc1nc(C)c2cc(C)c(=O)n(CCN3CCCCC3)c2n1.
What is the InChIKey of 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is HITXKAWJFCVWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O/c1-4-19-18-20-14(3)15-12-13(2)17(24)23(16(15)21-18)11-10-22-8-6-5-7-9-22/h12H,4-11H2,1-3H3,(H,19,20,21).
What are the key properties of 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one?
2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 329.45 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-4,6-dimethyl-8-(2-piperidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 137384116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).