C19H17N7O — CID 137384166
(Z)-2-amino-3-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,2-dihydropyridin-2-yl]prop-2-enal (PubChem CID 137384166) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is (Z)-2-amino-3-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,2-dihydropyridin-2-yl]prop-2-enal.
| Compound Name | (Z)-2-amino-3-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,2-dihydropyridin-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 137384166 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (Z)-2-amino-3-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,2-dihydropyridin-2-yl]prop-2-enal |
| SMILES | N/C(C=O)=C\C1C=CC(c2nccc(Nc3ccc4[nH]ncc4c3)n2)=CN1 |
| InChI | InChI=1S/C19H17N7O/c20-14(11-27)8-15-2-1-12(9-22-15)19-21-6-5-18(25-19)24-16-3-4-17-13(7-16)10-23-26-17/h1-11,15,22H,20H2,(H,23,26)(H,21,24,25)/b14-8- |
| InChIKey | UMGMFOZZLYGMHF-ZSOIEALJSA-N |
| XLogP | 2.01 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|