C21H17IN4O5S — CID 137384710
6-hydroxy-2-[3-[[2-hydroxy-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid (PubChem CID 137384710) has the molecular formula C21H17IN4O5S and a molecular weight of 564.36 g/mol. Its IUPAC name is 6-hydroxy-2-[3-[[2-hydroxy-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid.
| Compound Name | 6-hydroxy-2-[3-[[2-hydroxy-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 137384710 |
| Molecular Formula | C21H17IN4O5S |
| Molecular Weight | 564.36 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 6-hydroxy-2-[3-[[2-hydroxy-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl]-3-iodo-1-methylindole-5-carboxylic acid |
| SMILES | Cn1c(-c2cccc(NC(=O)C(O)Nc3nccs3)c2)c(I)c2cc(C(=O)O)c(O)cc21 |
| InChI | InChI=1S/C21H17IN4O5S/c1-26-14-9-15(27)13(20(30)31)8-12(14)16(22)17(26)10-3-2-4-11(7-10)24-18(28)19(29)25-21-23-5-6-32-21/h2-9,19,27,29H,1H3,(H,23,25)(H,24,28)(H,30,31) |
| InChIKey | YLGKUNVFAHRJHX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|