About ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate
ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 137384910) has the molecular formula C23H16F6N2O2
and a molecular weight of 466.38 g/mol. Its IUPAC name is ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate |
| PubChem CID | 137384910 |
| Molecular Formula | C23H16F6N2O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C23H16F6N2O2/c1-2-33-21(32)15(11-30)9-16-13-31(20-6-4-3-5-19(16)20)12-14-7-17(22(24,25)26)10-18(8-14)23(27,28)29/h3-10,13H,2,12H2,1H3/b15-9+ |
| InChIKey | JPDARXADBMCBEI-OQLLNIDSSA-N |
| XLogP | 6.20 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate?
The IUPAC name of ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate (CID 137384910) is ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate.
What is the SMILES notation for ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate?
The canonical SMILES for ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate is CCOC(=O)/C(C#N)=C/c1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc12.
What is the InChIKey of ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate?
The InChIKey is JPDARXADBMCBEI-OQLLNIDSSA-N. The full InChI is InChI=1S/C23H16F6N2O2/c1-2-33-21(32)15(11-30)9-16-13-31(20-6-4-3-5-19(16)20)12-14-7-17(22(24,25)26)10-18(8-14)23(27,28)29/h3-10,13H,2,12H2,1H3/b15-9+.
What are the key properties of ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate?
ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate has a molecular weight of 466.38 g/mol, XLogP of 6.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]-2-cyanoprop-2-enoate is sourced from PubChem (CID 137384910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).