About 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid
4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid (PubChem CID 137385206) has the molecular formula C27H27FN4O3
and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid |
| PubChem CID | 137385206 |
| Molecular Formula | C27H27FN4O3 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid |
| SMILES | NCCC[C@@H](N)CNC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2c1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H27FN4O3/c28-20-10-7-16(8-11-20)19-9-12-22-23(14-19)32-25(26(33)31-15-21(30)2-1-13-29)24(22)17-3-5-18(6-4-17)27(34)35/h3-12,14,21,32H,1-2,13,15,29-30H2,(H,31,33)(H,34,35)/t21-/m1/s1 |
| InChIKey | FVQNKQCFVRFMSU-OAQYLSRUSA-N |
| XLogP | 4.14 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid?
The IUPAC name of 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid (CID 137385206) is 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid.
What is the SMILES notation for 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid?
The canonical SMILES for 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid is NCCC[C@@H](N)CNC(=O)c1[nH]c2cc(-c3ccc(F)cc3)ccc2c1-c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid?
The InChIKey is FVQNKQCFVRFMSU-OAQYLSRUSA-N. The full InChI is InChI=1S/C27H27FN4O3/c28-20-10-7-16(8-11-20)19-9-12-22-23(14-19)32-25(26(33)31-15-21(30)2-1-13-29)24(22)17-3-5-18(6-4-17)27(34)35/h3-12,14,21,32H,1-2,13,15,29-30H2,(H,31,33)(H,34,35)/t21-/m1/s1.
What are the key properties of 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid?
4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid has a molecular weight of 474.54 g/mol, XLogP of 4.14, 9 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[(2R)-2,5-diaminopentyl]carbamoyl]-6-(4-fluorophenyl)-1H-indol-3-yl]benzoic acid is sourced from PubChem (CID 137385206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).