C33H34ClN5O2 — CID 137385999
(Z,2E)-5-(3-chloroquinolin-6-yl)-2-ethylidene-4-(methylideneamino)-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pent-3-enamide (PubChem CID 137385999) has the molecular formula C33H34ClN5O2 and a molecular weight of 568.12 g/mol. Its IUPAC name is (Z,2E)-5-(3-chloroquinolin-6-yl)-2-ethylidene-4-(methylideneamino)-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pent-3-enamide.
| Compound Name | (Z,2E)-5-(3-chloroquinolin-6-yl)-2-ethylidene-4-(methylideneamino)-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pent-3-enamide |
|---|---|
| PubChem CID | 137385999 |
| Molecular Formula | C33H34ClN5O2 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | (Z,2E)-5-(3-chloroquinolin-6-yl)-2-ethylidene-4-(methylideneamino)-N-[[2-methyl-6-(2-phenylmethoxyethylamino)-3-pyridinyl]methyl]pent-3-enamide |
| SMILES | C=N/C(=C\C(=C/C)C(=O)NCc1ccc(NCCOCc2ccccc2)nc1C)Cc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C33H34ClN5O2/c1-4-26(19-30(35-3)17-25-10-12-31-28(16-25)18-29(34)21-37-31)33(40)38-20-27-11-13-32(39-23(27)2)36-14-15-41-22-24-8-6-5-7-9-24/h4-13,16,18-19,21H,3,14-15,17,20,22H2,1-2H3,(H,36,39)(H,38,40)/b26-4+,30-19- |
| InChIKey | WCOQFDGVSVJHLB-JNYNLZKDSA-N |
| XLogP | 6.61 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|