C28H31N3 — CID 137386413
2-(4-cyclohepta-1,6-dien-1-ylcyclohexa-1,5-dien-1-yl)-6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,4-dihydro-1,3,5-triazine (PubChem CID 137386413) has the molecular formula C28H31N3 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-(4-cyclohepta-1,6-dien-1-ylcyclohexa-1,5-dien-1-yl)-6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(4-cyclohepta-1,6-dien-1-ylcyclohexa-1,5-dien-1-yl)-6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 137386413 |
| Molecular Formula | C28H31N3 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 2-(4-cyclohepta-1,6-dien-1-ylcyclohexa-1,5-dien-1-yl)-6-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CCCC(C2=NC(C3=CCCC=C3)N=C(C3=CCC(C4=CCCCC=C4)C=C3)N2)=C1 |
| InChI | InChI=1S/C28H31N3/c1-2-6-12-21(11-5-1)22-17-19-25(20-18-22)28-30-26(23-13-7-3-8-14-23)29-27(31-28)24-15-9-4-10-16-24/h3,5,7,9,11-13,15-17,19-20,22,27H,1-2,4,6,8,10,14,18H2,(H,29,30,31) |
| InChIKey | NCTFMCBZRPGQGK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |